C32H41N7O2 — CID 171624026
(1R,9R)-1,11,11-trimethyl-N-(3-methyl-4-morpholin-4-ylphenyl)-8-[6-[(2S)-pyrrolidin-2-yl]-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine (PubChem CID 171624026) has the molecular formula C32H41N7O2 and a molecular weight of 555.73 g/mol. Its IUPAC name is (1R,9R)-1,11,11-trimethyl-N-(3-methyl-4-morpholin-4-ylphenyl)-8-[6-[(2S)-pyrrolidin-2-yl]-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine.
| Compound Name | (1R,9R)-1,11,11-trimethyl-N-(3-methyl-4-morpholin-4-ylphenyl)-8-[6-[(2S)-pyrrolidin-2-yl]-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 171624026 |
| Molecular Formula | C32H41N7O2 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.33 |
| IUPAC Name | (1R,9R)-1,11,11-trimethyl-N-(3-methyl-4-morpholin-4-ylphenyl)-8-[6-[(2S)-pyrrolidin-2-yl]-2-pyridinyl]-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
| SMILES | Cc1cc(Nc2ncc3c(n2)N(c2cccc([C@@H]4CCCN4)n2)[C@@H]2CC(C)(C)OC[C@]32C)ccc1N1CCOCC1 |
| InChI | InChI=1S/C32H41N7O2/c1-21-17-22(10-11-26(21)38-13-15-40-16-14-38)35-30-34-19-23-29(37-30)39(27-18-31(2,3)41-20-32(23,27)4)28-9-5-7-25(36-28)24-8-6-12-33-24/h5,7,9-11,17,19,24,27,33H,6,8,12-16,18,20H2,1-4H3,(H,34,35,37)/t24-,27+,32+/m0/s1 |
| InChIKey | SUEFVKLMCVPOEH-WIIJYMMWSA-N |
| XLogP | 5.16 |
| TPSA | 87.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|