C28H35N7O — CID 171624342
(1R,9R)-1,11,11-trimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-pyridin-2-yl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine (PubChem CID 171624342) has the molecular formula C28H35N7O and a molecular weight of 485.64 g/mol. Its IUPAC name is (1R,9R)-1,11,11-trimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-pyridin-2-yl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine.
| Compound Name | (1R,9R)-1,11,11-trimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-pyridin-2-yl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
|---|---|
| PubChem CID | 171624342 |
| Molecular Formula | C28H35N7O |
| Molecular Weight | 485.64 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | (1R,9R)-1,11,11-trimethyl-N-[4-(4-methylpiperazin-1-yl)phenyl]-8-pyridin-2-yl-12-oxa-4,6,8-triazatricyclo[7.4.0.02,7]trideca-2,4,6-trien-5-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)N(c3ccccn3)[C@@H]3CC(C)(C)OC[C@]43C)cc2)CC1 |
| InChI | InChI=1S/C28H35N7O/c1-27(2)17-23-28(3,19-36-27)22-18-30-26(32-25(22)35(23)24-7-5-6-12-29-24)31-20-8-10-21(11-9-20)34-15-13-33(4)14-16-34/h5-12,18,23H,13-17,19H2,1-4H3,(H,30,31,32)/t23-,28-/m1/s1 |
| InChIKey | BOYXHHXRKIKIDD-QDPGVEIFSA-N |
| XLogP | 4.34 |
| TPSA | 69.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.64 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|