C14H23N3O3S2 — CID 171625364
tert-butyl N-[2-[[5-(dimethylaminosulfanyl)-2-methylthiophen-3-yl]amino]-2-oxoethyl]carbamate (PubChem CID 171625364) has the molecular formula C14H23N3O3S2 and a molecular weight of 345.49 g/mol. Its IUPAC name is tert-butyl N-[2-[[5-(dimethylaminosulfanyl)-2-methylthiophen-3-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[5-(dimethylaminosulfanyl)-2-methylthiophen-3-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 171625364 |
| Molecular Formula | C14H23N3O3S2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | tert-butyl N-[2-[[5-(dimethylaminosulfanyl)-2-methylthiophen-3-yl]amino]-2-oxoethyl]carbamate |
| SMILES | Cc1sc(SN(C)C)cc1NC(=O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23N3O3S2/c1-9-10(7-12(21-9)22-17(5)6)16-11(18)8-15-13(19)20-14(2,3)4/h7H,8H2,1-6H3,(H,15,19)(H,16,18) |
| InChIKey | ZVBZIKWDNBFUME-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|