C18H19N3O2S4 — CID 171625399
N-(2-methyl-5-thiomorpholin-4-ylsulfanylthiophen-3-yl)-2-(3-oxo-1,2-benzothiazol-2-yl)acetamide (PubChem CID 171625399) has the molecular formula C18H19N3O2S4 and a molecular weight of 437.64 g/mol. Its IUPAC name is N-(2-methyl-5-thiomorpholin-4-ylsulfanylthiophen-3-yl)-2-(3-oxo-1,2-benzothiazol-2-yl)acetamide.
| Compound Name | N-(2-methyl-5-thiomorpholin-4-ylsulfanylthiophen-3-yl)-2-(3-oxo-1,2-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 171625399 |
| Molecular Formula | C18H19N3O2S4 |
| Molecular Weight | 437.64 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-(2-methyl-5-thiomorpholin-4-ylsulfanylthiophen-3-yl)-2-(3-oxo-1,2-benzothiazol-2-yl)acetamide |
| SMILES | Cc1sc(SN2CCSCC2)cc1NC(=O)Cn1sc2ccccc2c1=O |
| InChI | InChI=1S/C18H19N3O2S4/c1-12-14(10-17(25-12)27-20-6-8-24-9-7-20)19-16(22)11-21-18(23)13-4-2-3-5-15(13)26-21/h2-5,10H,6-9,11H2,1H3,(H,19,22) |
| InChIKey | IHOVTSNITCFBKI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.64 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|