C22H25BrF2N4OSi — CID 171630083
2-[[9-bromo-5-(2,6-difluorophenyl)-5,6-dihydro-4H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630083) has the molecular formula C22H25BrF2N4OSi and a molecular weight of 507.46 g/mol. Its IUPAC name is 2-[[9-bromo-5-(2,6-difluorophenyl)-5,6-dihydro-4H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[9-bromo-5-(2,6-difluorophenyl)-5,6-dihydro-4H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630083 |
| Molecular Formula | C22H25BrF2N4OSi |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 2-[[9-bromo-5-(2,6-difluorophenyl)-5,6-dihydro-4H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ncc2c1-c1cc(Br)ccc1NC(c1c(F)cccc1F)N2 |
| InChI | InChI=1S/C22H25BrF2N4OSi/c1-31(2,3)10-9-30-13-29-21-15-11-14(23)7-8-18(15)27-22(28-19(21)12-26-29)20-16(24)5-4-6-17(20)25/h4-8,11-12,22,27-28H,9-10,13H2,1-3H3 |
| InChIKey | XBAPNJAPOULCQO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 51.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|