C22H22BrClF2N4OSi — CID 171630180
2-[[9-bromo-3-chloro-5-(2,6-difluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630180) has the molecular formula C22H22BrClF2N4OSi and a molecular weight of 539.88 g/mol. Its IUPAC name is 2-[[9-bromo-3-chloro-5-(2,6-difluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[9-bromo-3-chloro-5-(2,6-difluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630180 |
| Molecular Formula | C22H22BrClF2N4OSi |
| Molecular Weight | 539.88 g/mol |
| Exact Mass | 538.04 |
| IUPAC Name | 2-[[9-bromo-3-chloro-5-(2,6-difluorophenyl)-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1nc(Cl)c2c1-c1cc(Br)ccc1NC(c1c(F)cccc1F)=N2 |
| InChI | InChI=1S/C22H22BrClF2N4OSi/c1-32(2,3)10-9-31-12-30-20-14-11-13(23)7-8-17(14)27-22(28-19(20)21(24)29-30)18-15(25)5-4-6-16(18)26/h4-8,11H,9-10,12H2,1-3H3,(H,27,28) |
| InChIKey | USSVIYGLFOKZGU-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.88 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|