C23H25BrF2N4OSi — CID 171630154
2-[[9-bromo-5-(2,6-difluorophenyl)-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630154) has the molecular formula C23H25BrF2N4OSi and a molecular weight of 519.47 g/mol. Its IUPAC name is 2-[[9-bromo-5-(2,6-difluorophenyl)-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[9-bromo-5-(2,6-difluorophenyl)-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630154 |
| Molecular Formula | C23H25BrF2N4OSi |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.09 |
| IUPAC Name | 2-[[9-bromo-5-(2,6-difluorophenyl)-3-methyl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)cccc1F)Nc1ccc(Br)cc1-2 |
| InChI | InChI=1S/C23H25BrF2N4OSi/c1-14-21-22(30(29-14)13-31-10-11-32(2,3)4)16-12-15(24)8-9-19(16)27-23(28-21)20-17(25)6-5-7-18(20)26/h5-9,12H,10-11,13H2,1-4H3,(H,27,28) |
| InChIKey | ARAPTHIPWXEZDU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|