C27H32ClF2N5O2Si — CID 171630315
2-[[5-(3-chloro-2,6-difluorophenyl)-3-methyl-9-morpholin-4-yl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 171630315) has the molecular formula C27H32ClF2N5O2Si and a molecular weight of 560.12 g/mol. Its IUPAC name is 2-[[5-(3-chloro-2,6-difluorophenyl)-3-methyl-9-morpholin-4-yl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(3-chloro-2,6-difluorophenyl)-3-methyl-9-morpholin-4-yl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 171630315 |
| Molecular Formula | C27H32ClF2N5O2Si |
| Molecular Weight | 560.12 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | 2-[[5-(3-chloro-2,6-difluorophenyl)-3-methyl-9-morpholin-4-yl-6H-pyrazolo[4,5-d][1,3]benzodiazepin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | Cc1nn(COCC[Si](C)(C)C)c2c1N=C(c1c(F)ccc(Cl)c1F)Nc1ccc(N3CCOCC3)cc1-2 |
| InChI | InChI=1S/C27H32ClF2N5O2Si/c1-17-25-26(35(33-17)16-37-13-14-38(2,3)4)19-15-18(34-9-11-36-12-10-34)5-8-22(19)31-27(32-25)23-21(29)7-6-20(28)24(23)30/h5-8,15H,9-14,16H2,1-4H3,(H,31,32) |
| InChIKey | FAJYVIBDMFNCFU-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 63.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.12 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|