C17H24N4 — CID 171630553
N-methyl-N'-(3-methylbut-1-en-2-yl)ethane-1,2-diimine;6-propan-2-ylpyridine-3-carbonitrile (PubChem CID 171630553) has the molecular formula C17H24N4 and a molecular weight of 284.41 g/mol. Its IUPAC name is N-methyl-N'-(3-methylbut-1-en-2-yl)ethane-1,2-diimine;6-propan-2-ylpyridine-3-carbonitrile.
| Compound Name | N-methyl-N'-(3-methylbut-1-en-2-yl)ethane-1,2-diimine;6-propan-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 171630553 |
| Molecular Formula | C17H24N4 |
| Molecular Weight | 284.41 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N-methyl-N'-(3-methylbut-1-en-2-yl)ethane-1,2-diimine;6-propan-2-ylpyridine-3-carbonitrile |
| SMILES | C=C(/N=C/C=N/C)C(C)C.CC(C)c1ccc(C#N)cn1 |
| InChI | InChI=1S/C9H10N2.C8H14N2/c1-7(2)9-4-3-8(5-10)6-11-9;1-7(2)8(3)10-6-5-9-4/h3-4,6-7H,1-2H3;5-7H,3H2,1-2,4H3/b;9-5+,10-6+ |
| InChIKey | NUVHAWCOTUNTBC-SWCAGSNTSA-N |
| XLogP | 4.00 |
| TPSA | 61.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|