C38H35FN8O4 — CID 171637119
3-[1-[[3-[5-[[1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile (PubChem CID 171637119) has the molecular formula C38H35FN8O4 and a molecular weight of 686.75 g/mol. Its IUPAC name is 3-[1-[[3-[5-[[1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile.
| Compound Name | 3-[1-[[3-[5-[[1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 171637119 |
| Molecular Formula | C38H35FN8O4 |
| Molecular Weight | 686.75 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | 3-[1-[[3-[5-[[1-[[1-(2-fluoro-4-nitrophenyl)azetidin-3-yl]methyl]piperidin-4-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(=O)n(Cc3cccc(-c4ncc(OCC5CCN(CC6CN(c7ccc([N+](=O)[O-])cc7F)C6)CC5)cn4)c3)n2)c1 |
| InChI | InChI=1S/C38H35FN8O4/c39-34-17-32(47(49)50)7-9-36(34)45-22-29(23-45)21-44-13-11-26(12-14-44)25-51-33-19-41-38(42-20-33)31-6-2-4-28(16-31)24-46-37(48)10-8-35(43-46)30-5-1-3-27(15-30)18-40/h1-10,15-17,19-20,26,29H,11-14,21-25H2 |
| InChIKey | DUOFWXWUVRGNFP-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 143.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.75 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|