C38H33FN8O5 — CID 171637268
3-[1-[[3-[5-[[(2R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]morpholin-2-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile (PubChem CID 171637268) has the molecular formula C38H33FN8O5 and a molecular weight of 700.73 g/mol. Its IUPAC name is 3-[1-[[3-[5-[[(2R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]morpholin-2-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile.
| Compound Name | 3-[1-[[3-[5-[[(2R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]morpholin-2-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
|---|---|
| PubChem CID | 171637268 |
| Molecular Formula | C38H33FN8O5 |
| Molecular Weight | 700.73 g/mol |
| Exact Mass | 700.26 |
| IUPAC Name | 3-[1-[[3-[5-[[(2R)-4-[4-[(2,6-dioxopiperidin-3-yl)amino]-2-fluorophenyl]morpholin-2-yl]methoxy]pyrimidin-2-yl]phenyl]methyl]-6-oxopyridazin-3-yl]benzonitrile |
| SMILES | N#Cc1cccc(-c2ccc(=O)n(Cc3cccc(-c4ncc(OC[C@H]5CN(c6ccc(NC7CCC(=O)NC7=O)cc6F)CCO5)cn4)c3)n2)c1 |
| InChI | InChI=1S/C38H33FN8O5/c39-31-17-28(43-33-8-11-35(48)44-38(33)50)7-10-34(31)46-13-14-51-30(22-46)23-52-29-19-41-37(42-20-29)27-6-2-4-25(16-27)21-47-36(49)12-9-32(45-47)26-5-1-3-24(15-26)18-40/h1-7,9-10,12,15-17,19-20,30,33,43H,8,11,13-14,21-23H2,(H,44,48,50)/t30-,33?/m1/s1 |
| InChIKey | AIKMCKPVPBOTBE-UEACTRMWSA-N |
| XLogP | 3.93 |
| TPSA | 164.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.73 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|