C20H22N4O5 — CID 171637191
1-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-4-oxophthalazin-6-yl]piperidine-4-carboxylic acid (PubChem CID 171637191) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is 1-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-4-oxophthalazin-6-yl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-4-oxophthalazin-6-yl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 171637191 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-[3-(2,6-dioxopiperidin-3-yl)-1-methyl-4-oxophthalazin-6-yl]piperidine-4-carboxylic acid |
| SMILES | Cc1nn(C2CCC(=O)NC2=O)c(=O)c2cc(N3CCC(C(=O)O)CC3)ccc12 |
| InChI | InChI=1S/C20H22N4O5/c1-11-14-3-2-13(23-8-6-12(7-9-23)20(28)29)10-15(14)19(27)24(22-11)16-4-5-17(25)21-18(16)26/h2-3,10,12,16H,4-9H2,1H3,(H,28,29)(H,21,25,26) |
| InChIKey | RGTHMJWKLBJRMF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|