C11H13N3S — CID 171637612
N'-isoquinolin-5-ylsulfanylethane-1,2-diamine (PubChem CID 171637612) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is N'-isoquinolin-5-ylsulfanylethane-1,2-diamine.
| Compound Name | N'-isoquinolin-5-ylsulfanylethane-1,2-diamine |
|---|---|
| PubChem CID | 171637612 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N'-isoquinolin-5-ylsulfanylethane-1,2-diamine |
| SMILES | NCCNSc1cccc2cnccc12 |
| InChI | InChI=1S/C11H13N3S/c12-5-7-14-15-11-3-1-2-9-8-13-6-4-10(9)11/h1-4,6,8,14H,5,7,12H2 |
| InChIKey | PSOGVKJIOJPOFF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|