C19H25N3O5S — CID 171647343
N-(1,3-benzodioxol-5-ylmethyl)-2-[[1-(2-hydroxyethyl)-2-oxo-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[d]pyrimidin-4-yl]sulfanyl]acetamide (PubChem CID 171647343) has the molecular formula C19H25N3O5S and a molecular weight of 407.49 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2-[[1-(2-hydroxyethyl)-2-oxo-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[d]pyrimidin-4-yl]sulfanyl]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[1-(2-hydroxyethyl)-2-oxo-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[d]pyrimidin-4-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 171647343 |
| Molecular Formula | C19H25N3O5S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2-[[1-(2-hydroxyethyl)-2-oxo-4,4a,5,6,7,7a-hexahydro-3H-cyclopenta[d]pyrimidin-4-yl]sulfanyl]acetamide |
| SMILES | O=C(CSC1NC(=O)N(CCO)C2CCCC12)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H25N3O5S/c23-7-6-22-14-3-1-2-13(14)18(21-19(22)25)28-10-17(24)20-9-12-4-5-15-16(8-12)27-11-26-15/h4-5,8,13-14,18,23H,1-3,6-7,9-11H2,(H,20,24)(H,21,25) |
| InChIKey | PNTHKUMFJHKTFF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |