C16H18N2O3S — CID 171650264
1-(4-methylphenyl)sulfonyl-4,5,6,7-tetrahydroindole-6-carboxamide (PubChem CID 171650264) has the molecular formula C16H18N2O3S and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-4,5,6,7-tetrahydroindole-6-carboxamide.
| Compound Name | 1-(4-methylphenyl)sulfonyl-4,5,6,7-tetrahydroindole-6-carboxamide |
|---|---|
| PubChem CID | 171650264 |
| Molecular Formula | C16H18N2O3S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-4,5,6,7-tetrahydroindole-6-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2CC(C(N)=O)CC3)cc1 |
| InChI | InChI=1S/C16H18N2O3S/c1-11-2-6-14(7-3-11)22(20,21)18-9-8-12-4-5-13(16(17)19)10-15(12)18/h2-3,6-9,13H,4-5,10H2,1H3,(H2,17,19) |
| InChIKey | OEEQDDZMOYNKKT-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 82.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |