C24H21F3N2O6S2 — CID 171651696
ethyl 2-[[2-[3-(methylsulfanylamino)benzoyl]oxyacetyl]amino]-5-[3-(trifluoromethoxy)phenyl]thiophene-3-carboxylate (PubChem CID 171651696) has the molecular formula C24H21F3N2O6S2 and a molecular weight of 554.57 g/mol. Its IUPAC name is ethyl 2-[[2-[3-(methylsulfanylamino)benzoyl]oxyacetyl]amino]-5-[3-(trifluoromethoxy)phenyl]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[3-(methylsulfanylamino)benzoyl]oxyacetyl]amino]-5-[3-(trifluoromethoxy)phenyl]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 171651696 |
| Molecular Formula | C24H21F3N2O6S2 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.08 |
| IUPAC Name | ethyl 2-[[2-[3-(methylsulfanylamino)benzoyl]oxyacetyl]amino]-5-[3-(trifluoromethoxy)phenyl]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cccc(OC(F)(F)F)c2)sc1NC(=O)COC(=O)c1cccc(NSC)c1 |
| InChI | InChI=1S/C24H21F3N2O6S2/c1-3-33-23(32)18-12-19(14-6-5-9-17(11-14)35-24(25,26)27)37-21(18)28-20(30)13-34-22(31)15-7-4-8-16(10-15)29-36-2/h4-12,29H,3,13H2,1-2H3,(H,28,30) |
| InChIKey | BLARIMLHAICPKH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|