C24H27N3O3S2 — CID 171651823
ethyl 2-[3-[N-methyl-3-(methylsulfanylamino)anilino]propanoylamino]-5-phenylthiophene-3-carboxylate (PubChem CID 171651823) has the molecular formula C24H27N3O3S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is ethyl 2-[3-[N-methyl-3-(methylsulfanylamino)anilino]propanoylamino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[3-[N-methyl-3-(methylsulfanylamino)anilino]propanoylamino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 171651823 |
| Molecular Formula | C24H27N3O3S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | ethyl 2-[3-[N-methyl-3-(methylsulfanylamino)anilino]propanoylamino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)CCN(C)c1cccc(NSC)c1 |
| InChI | InChI=1S/C24H27N3O3S2/c1-4-30-24(29)20-16-21(17-9-6-5-7-10-17)32-23(20)25-22(28)13-14-27(2)19-12-8-11-18(15-19)26-31-3/h5-12,15-16,26H,4,13-14H2,1-3H3,(H,25,28) |
| InChIKey | QKRVTYIGJHGOLS-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|