C24H27N5O3S2 — CID 171651571
ethyl 2-[[2-[amino-[(Z)-2-amino-1-[3-(methylsulfanylamino)phenyl]ethenyl]amino]acetyl]amino]-5-phenylthiophene-3-carboxylate (PubChem CID 171651571) has the molecular formula C24H27N5O3S2 and a molecular weight of 497.65 g/mol. Its IUPAC name is ethyl 2-[[2-[amino-[(Z)-2-amino-1-[3-(methylsulfanylamino)phenyl]ethenyl]amino]acetyl]amino]-5-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[amino-[(Z)-2-amino-1-[3-(methylsulfanylamino)phenyl]ethenyl]amino]acetyl]amino]-5-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 171651571 |
| Molecular Formula | C24H27N5O3S2 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | ethyl 2-[[2-[amino-[(Z)-2-amino-1-[3-(methylsulfanylamino)phenyl]ethenyl]amino]acetyl]amino]-5-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)sc1NC(=O)CN(N)/C(=C\N)c1cccc(NSC)c1 |
| InChI | InChI=1S/C24H27N5O3S2/c1-3-32-24(31)19-13-21(16-8-5-4-6-9-16)34-23(19)27-22(30)15-29(26)20(14-25)17-10-7-11-18(12-17)28-33-2/h4-14,28H,3,15,25-26H2,1-2H3,(H,27,30)/b20-14- |
| InChIKey | GHQQIYSCBYOTRS-ZHZULCJRSA-N |
| XLogP | 4.35 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|