C15H31NO — CID 171652279
ethane;4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine (PubChem CID 171652279) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine.
| Compound Name | ethane;4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine |
|---|---|
| PubChem CID | 171652279 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | ethane;4-[(2E)-2-ethenylpenta-2,4-dienoxy]butan-1-amine |
| SMILES | C=C/C=C(\C=C)COCCCCN.CC.CC |
| InChI | InChI=1S/C11H19NO.2C2H6/c1-3-7-11(4-2)10-13-9-6-5-8-12;2*1-2/h3-4,7H,1-2,5-6,8-10,12H2;2*1-2H3/b11-7+;; |
| InChIKey | AHRWJELAGDVNGE-FCVAESPPSA-N |
| XLogP | 4.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|