C11H10BN2O4 — CID 171653993
CID 171653993 (PubChem CID 171653993) has the molecular formula C11H10BN2O4 and a molecular weight of 245.02 g/mol.
| Compound Name | CID 171653993 |
|---|---|
| PubChem CID | 171653993 |
| Molecular Formula | C11H10BN2O4 |
| Molecular Weight | 245.02 g/mol |
| Exact Mass | 245.07 |
| IUPAC Name | — |
| SMILES | [B]=C1C=CC(=O)N1CC(=O)ON1C(=C)CCC1=O |
| InChI | InChI=1S/C11H10BN2O4/c1-7-2-4-10(16)14(7)18-11(17)6-13-8(12)3-5-9(13)15/h3,5H,1-2,4,6H2 |
| InChIKey | QFJPKOBZGPKUGE-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.02 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|