C16H29BN2O5 — CID 171656203
(2S)-1-(2-methoxyethoxy)-3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol (PubChem CID 171656203) has the molecular formula C16H29BN2O5 and a molecular weight of 340.23 g/mol. Its IUPAC name is (2S)-1-(2-methoxyethoxy)-3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol.
| Compound Name | (2S)-1-(2-methoxyethoxy)-3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 171656203 |
| Molecular Formula | C16H29BN2O5 |
| Molecular Weight | 340.23 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2S)-1-(2-methoxyethoxy)-3-[3-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazol-1-yl]propan-2-ol |
| SMILES | COCCOC[C@@H](O)Cn1cc(B2OC(C)(C)C(C)(C)O2)c(C)n1 |
| InChI | InChI=1S/C16H29BN2O5/c1-12-14(17-23-15(2,3)16(4,5)24-17)10-19(18-12)9-13(20)11-22-8-7-21-6/h10,13,20H,7-9,11H2,1-6H3/t13-/m0/s1 |
| InChIKey | GWCGIHTZFGYIDN-ZDUSSCGKSA-N |
| XLogP | 0.51 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|