C10H7Cl2NO — CID 171656642
4-amino-5,6-dichloronaphthalen-2-ol (PubChem CID 171656642) has the molecular formula C10H7Cl2NO and a molecular weight of 228.08 g/mol. Its IUPAC name is 4-amino-5,6-dichloronaphthalen-2-ol.
| Compound Name | 4-amino-5,6-dichloronaphthalen-2-ol |
|---|---|
| PubChem CID | 171656642 |
| Molecular Formula | C10H7Cl2NO |
| Molecular Weight | 228.08 g/mol |
| Exact Mass | 226.99 |
| IUPAC Name | 4-amino-5,6-dichloronaphthalen-2-ol |
| SMILES | Nc1cc(O)cc2ccc(Cl)c(Cl)c12 |
| InChI | InChI=1S/C10H7Cl2NO/c11-7-2-1-5-3-6(14)4-8(13)9(5)10(7)12/h1-4,14H,13H2 |
| InChIKey | CBSWPVAAHAOICK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.08 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|