About 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol
8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol (PubChem CID 158485356) has the molecular formula C20H17ClN2O2
and a molecular weight of 352.82 g/mol. Its IUPAC name is 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol.
Molecular Properties
| Compound Name | 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol |
| PubChem CID | 158485356 |
| Molecular Formula | C20H17ClN2O2 |
| Molecular Weight | 352.82 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol |
| SMILES | Nc1c(Cl)ccc2ccc(O)cc12.Nc1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C10H8ClNO.C10H9NO/c11-9-4-2-6-1-3-7(13)5-8(6)10(9)12;11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-5,13H,12H2;1-6,12H,11H2 |
| InChIKey | HIAJWKICMVFZQS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.82 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol?
The IUPAC name of 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol (CID 158485356) is 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol.
What is the SMILES notation for 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol?
The canonical SMILES for 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol is Nc1c(Cl)ccc2ccc(O)cc12.Nc1cccc2ccc(O)cc12.
What is the InChIKey of 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol?
The InChIKey is HIAJWKICMVFZQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClNO.C10H9NO/c11-9-4-2-6-1-3-7(13)5-8(6)10(9)12;11-10-3-1-2-7-4-5-8(12)6-9(7)10/h1-5,13H,12H2;1-6,12H,11H2.
What are the key properties of 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol?
8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol has a molecular weight of 352.82 g/mol, XLogP of 4.91, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-7-chloronaphthalen-2-ol;8-aminonaphthalen-2-ol is sourced from PubChem (CID 158485356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).