C45H36Cl2N4O3 — CID 157457277
8-amino-7-chloronaphthalen-2-ol;1-(2-chloro-7-hydroxynaphthalen-1-yl)-3-(3-phenylphenyl)urea;3-phenylaniline (PubChem CID 157457277) has the molecular formula C45H36Cl2N4O3 and a molecular weight of 751.71 g/mol. Its IUPAC name is 8-amino-7-chloronaphthalen-2-ol;1-(2-chloro-7-hydroxynaphthalen-1-yl)-3-(3-phenylphenyl)urea;3-phenylaniline.
| Compound Name | 8-amino-7-chloronaphthalen-2-ol;1-(2-chloro-7-hydroxynaphthalen-1-yl)-3-(3-phenylphenyl)urea;3-phenylaniline |
|---|---|
| PubChem CID | 157457277 |
| Molecular Formula | C45H36Cl2N4O3 |
| Molecular Weight | 751.71 g/mol |
| Exact Mass | 750.22 |
| IUPAC Name | 8-amino-7-chloronaphthalen-2-ol;1-(2-chloro-7-hydroxynaphthalen-1-yl)-3-(3-phenylphenyl)urea;3-phenylaniline |
| SMILES | Nc1c(Cl)ccc2ccc(O)cc12.Nc1cccc(-c2ccccc2)c1.O=C(Nc1cccc(-c2ccccc2)c1)Nc1c(Cl)ccc2ccc(O)cc12 |
| InChI | InChI=1S/C23H17ClN2O2.C12H11N.C10H8ClNO/c24-21-12-10-16-9-11-19(27)14-20(16)22(21)26-23(28)25-18-8-4-7-17(13-18)15-5-2-1-3-6-15;13-12-8-4-7-11(9-12)10-5-2-1-3-6-10;11-9-4-2-6-1-3-7(13)5-8(6)10(9)12/h1-14,27H,(H2,25,26,28);1-9H,13H2;1-5,13H,12H2 |
| InChIKey | BTMXJILNOFXWQG-UHFFFAOYSA-N |
| XLogP | 12.23 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.71 |
| LogP ≤ 5 | 12.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|