C13H22N2O2 — CID 171659129
4,5-bis(ethenyl)-N-(ethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide;molecular hydrogen (PubChem CID 171659129) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-N-(ethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide;molecular hydrogen.
| Compound Name | 4,5-bis(ethenyl)-N-(ethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 171659129 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 4,5-bis(ethenyl)-N-(ethoxymethyl)-3,6-dihydro-2H-pyridine-1-carboxamide;molecular hydrogen |
| SMILES | C=CC1=C(C=C)CN(C(=O)NCOCC)CC1.[H][H] |
| InChI | InChI=1S/C13H20N2O2.H2/c1-4-11-7-8-15(9-12(11)5-2)13(16)14-10-17-6-3;/h4-5H,1-2,6-10H2,3H3,(H,14,16);1H |
| InChIKey | ANLLKOCIQOCWDN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|