About CID 171659458
CID 171659458 (PubChem CID 171659458) has the molecular formula C18H25B3ClN7O2
and a molecular weight of 439.33 g/mol.
Molecular Properties
| Compound Name | CID 171659458 |
| PubChem CID | 171659458 |
| Molecular Formula | C18H25B3ClN7O2 |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | — |
| SMILES | OC1CCCOC1.[B]C([B])([B])N1CCC(c2nnc(-c3nc(N)ncc3Cl)n2C)CC1 |
| InChI | InChI=1S/C13H15B3ClN7.C5H10O2/c1-23-10(7-2-4-24(5-3-7)13(14,15)16)21-22-11(23)9-8(17)6-19-12(18)20-9;6-5-2-1-3-7-4-5/h6-7H,2-5H2,1H3,(H2,18,19,20);5-6H,1-4H2 |
| InChIKey | JHHWAZMYKHCDGL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 171659458 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171659458?
The IUPAC name of CID 171659458 (CID 171659458) is not available.
What is the SMILES notation for CID 171659458?
The canonical SMILES for CID 171659458 is OC1CCCOC1.[B]C([B])([B])N1CCC(c2nnc(-c3nc(N)ncc3Cl)n2C)CC1.
What is the InChIKey of CID 171659458?
The InChIKey is JHHWAZMYKHCDGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15B3ClN7.C5H10O2/c1-23-10(7-2-4-24(5-3-7)13(14,15)16)21-22-11(23)9-8(17)6-19-12(18)20-9;6-5-2-1-3-7-4-5/h6-7H,2-5H2,1H3,(H2,18,19,20);5-6H,1-4H2.
What are the key properties of CID 171659458?
CID 171659458 has a molecular weight of 439.33 g/mol, XLogP of -0.04, 3 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171659458 is sourced from PubChem (CID 171659458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).