C18H25B3ClN7O2 — CID 171659458
CID 171659458 (PubChem CID 171659458) has the molecular formula C18H25B3ClN7O2 and a molecular weight of 439.33 g/mol.
| Compound Name | CID 171659458 |
|---|---|
| PubChem CID | 171659458 |
| Molecular Formula | C18H25B3ClN7O2 |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | — |
| SMILES | OC1CCCOC1.[B]C([B])([B])N1CCC(c2nnc(-c3nc(N)ncc3Cl)n2C)CC1 |
| InChI | InChI=1S/C13H15B3ClN7.C5H10O2/c1-23-10(7-2-4-24(5-3-7)13(14,15)16)21-22-11(23)9-8(17)6-19-12(18)20-9;6-5-2-1-3-7-4-5/h6-7H,2-5H2,1H3,(H2,18,19,20);5-6H,1-4H2 |
| InChIKey | JHHWAZMYKHCDGL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|