C10H15N3 — CID 171660593
1-methyl-5-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]-1,2,4-triazole (PubChem CID 171660593) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-methyl-5-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]-1,2,4-triazole.
| Compound Name | 1-methyl-5-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 171660593 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 1-methyl-5-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]-1,2,4-triazole |
| SMILES | C=C/C(=C\c1ncnn1C)C(C)C |
| InChI | InChI=1S/C10H15N3/c1-5-9(8(2)3)6-10-11-7-12-13(10)4/h5-8H,1H2,2-4H3/b9-6+ |
| InChIKey | OMAWBFHQDFJBFD-RMKNXTFCSA-N |
| XLogP | 2.04 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|