C18H29F3N2O4 — CID 171677686
(1S,2R,3R,4R)-N-[(2S)-1-hydroxyhexan-2-yl]-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 171677686) has the molecular formula C18H29F3N2O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is (1S,2R,3R,4R)-N-[(2S)-1-hydroxyhexan-2-yl]-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,3R,4R)-N-[(2S)-1-hydroxyhexan-2-yl]-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 171677686 |
| Molecular Formula | C18H29F3N2O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | (1S,2R,3R,4R)-N-[(2S)-1-hydroxyhexan-2-yl]-3-[(3,3,3-trifluoro-2-hydroxy-2-methylpropanoyl)amino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CCCC[C@@H](CO)NC(=O)[C@@H]1[C@H]2CC[C@H](C2)[C@H]1NC(=O)C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C18H29F3N2O4/c1-3-4-5-12(9-24)22-15(25)13-10-6-7-11(8-10)14(13)23-16(26)17(2,27)18(19,20)21/h10-14,24,27H,3-9H2,1-2H3,(H,22,25)(H,23,26)/t10-,11+,12-,13+,14+,17?/m0/s1 |
| InChIKey | PAWVZXUIYUFEAD-GTLMZYGQSA-N |
| XLogP | 1.50 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |