C19H28N4O3 — CID 171680300
ethyl 2-ethyl-2-(imidazo[1,2-a]pyrazine-3-carbonylamino)octanoate (PubChem CID 171680300) has the molecular formula C19H28N4O3 and a molecular weight of 360.46 g/mol. Its IUPAC name is ethyl 2-ethyl-2-(imidazo[1,2-a]pyrazine-3-carbonylamino)octanoate.
| Compound Name | ethyl 2-ethyl-2-(imidazo[1,2-a]pyrazine-3-carbonylamino)octanoate |
|---|---|
| PubChem CID | 171680300 |
| Molecular Formula | C19H28N4O3 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | ethyl 2-ethyl-2-(imidazo[1,2-a]pyrazine-3-carbonylamino)octanoate |
| SMILES | CCCCCCC(CC)(NC(=O)c1cnc2cnccn12)C(=O)OCC |
| InChI | InChI=1S/C19H28N4O3/c1-4-7-8-9-10-19(5-2,18(25)26-6-3)22-17(24)15-13-21-16-14-20-11-12-23(15)16/h11-14H,4-10H2,1-3H3,(H,22,24) |
| InChIKey | MTDYFMKKKOOILP-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|