C29H29F3N4O3 — CID 171681401
(E)-N-benzyl-N'-[4-[1-[1-methyl-5-(trifluoromethyl)pyrrole-2-carbonyl]piperidin-4-yl]phenyl]but-2-enediamide (PubChem CID 171681401) has the molecular formula C29H29F3N4O3 and a molecular weight of 538.57 g/mol. Its IUPAC name is (E)-N-benzyl-N'-[4-[1-[1-methyl-5-(trifluoromethyl)pyrrole-2-carbonyl]piperidin-4-yl]phenyl]but-2-enediamide.
| Compound Name | (E)-N-benzyl-N'-[4-[1-[1-methyl-5-(trifluoromethyl)pyrrole-2-carbonyl]piperidin-4-yl]phenyl]but-2-enediamide |
|---|---|
| PubChem CID | 171681401 |
| Molecular Formula | C29H29F3N4O3 |
| Molecular Weight | 538.57 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (E)-N-benzyl-N'-[4-[1-[1-methyl-5-(trifluoromethyl)pyrrole-2-carbonyl]piperidin-4-yl]phenyl]but-2-enediamide |
| SMILES | Cn1c(C(=O)N2CCC(c3ccc(NC(=O)/C=C/C(=O)NCc4ccccc4)cc3)CC2)ccc1C(F)(F)F |
| InChI | InChI=1S/C29H29F3N4O3/c1-35-24(11-12-25(35)29(30,31)32)28(39)36-17-15-22(16-18-36)21-7-9-23(10-8-21)34-27(38)14-13-26(37)33-19-20-5-3-2-4-6-20/h2-14,22H,15-19H2,1H3,(H,33,37)(H,34,38)/b14-13+ |
| InChIKey | SAHCEGGQBIVXOA-BUHFOSPRSA-N |
| XLogP | 4.87 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.57 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|