C30H38N2O5 — CID 171682929
2-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]cyclopentane-1-carboxamide (PubChem CID 171682929) has the molecular formula C30H38N2O5 and a molecular weight of 506.64 g/mol. Its IUPAC name is 2-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]cyclopentane-1-carboxamide.
| Compound Name | 2-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 171682929 |
| Molecular Formula | C30H38N2O5 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.28 |
| IUPAC Name | 2-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]cyclopentane-1-carboxamide |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC(c3ccc(NC(=O)C4CCCC4C)cc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C30H38N2O5/c1-20-6-5-7-25(20)30(34)31-24-12-8-21(9-13-24)22-16-18-32(19-17-22)27(33)15-11-23-10-14-26(35-2)29(37-4)28(23)36-3/h8-15,20,22,25H,5-7,16-19H2,1-4H3,(H,31,34)/b15-11+ |
| InChIKey | MPYVYZZZSSLJDW-RVDMUPIBSA-N |
| XLogP | 5.51 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|