C29H32FN3O5 — CID 171683745
4-fluoro-1-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]pyrrole-2-carboxamide (PubChem CID 171683745) has the molecular formula C29H32FN3O5 and a molecular weight of 521.59 g/mol. Its IUPAC name is 4-fluoro-1-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]pyrrole-2-carboxamide.
| Compound Name | 4-fluoro-1-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 171683745 |
| Molecular Formula | C29H32FN3O5 |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 4-fluoro-1-methyl-N-[4-[1-[(E)-3-(2,3,4-trimethoxyphenyl)prop-2-enoyl]piperidin-4-yl]phenyl]pyrrole-2-carboxamide |
| SMILES | COc1ccc(/C=C/C(=O)N2CCC(c3ccc(NC(=O)c4cc(F)cn4C)cc3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C29H32FN3O5/c1-32-18-22(30)17-24(32)29(35)31-23-9-5-19(6-10-23)20-13-15-33(16-14-20)26(34)12-8-21-7-11-25(36-2)28(38-4)27(21)37-3/h5-12,17-18,20H,13-16H2,1-4H3,(H,31,35)/b12-8+ |
| InChIKey | MYGRZCKGBIMHFL-XYOKQWHBSA-N |
| XLogP | 4.86 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|