C34H39N3O3 — CID 171683187
(E)-N-[4-[1-(1-benzylpiperidine-3-carbonyl)piperidin-4-yl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide (PubChem CID 171683187) has the molecular formula C34H39N3O3 and a molecular weight of 537.70 g/mol. Its IUPAC name is (E)-N-[4-[1-(1-benzylpiperidine-3-carbonyl)piperidin-4-yl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-[1-(1-benzylpiperidine-3-carbonyl)piperidin-4-yl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 171683187 |
| Molecular Formula | C34H39N3O3 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.30 |
| IUPAC Name | (E)-N-[4-[1-(1-benzylpiperidine-3-carbonyl)piperidin-4-yl]phenyl]-3-(3-methoxyphenyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)Nc2ccc(C3CCN(C(=O)C4CCCN(Cc5ccccc5)C4)CC3)cc2)c1 |
| InChI | InChI=1S/C34H39N3O3/c1-40-32-11-5-9-26(23-32)12-17-33(38)35-31-15-13-28(14-16-31)29-18-21-37(22-19-29)34(39)30-10-6-20-36(25-30)24-27-7-3-2-4-8-27/h2-5,7-9,11-17,23,29-30H,6,10,18-22,24-25H2,1H3,(H,35,38)/b17-12+ |
| InChIKey | DPDAUFSFHDKTTH-SFQUDFHCSA-N |
| XLogP | 5.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|