C33H34F3N3O2 — CID 171681474
1-benzyl-N-[4-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]phenyl]piperidine-3-carboxamide (PubChem CID 171681474) has the molecular formula C33H34F3N3O2 and a molecular weight of 561.65 g/mol. Its IUPAC name is 1-benzyl-N-[4-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]phenyl]piperidine-3-carboxamide.
| Compound Name | 1-benzyl-N-[4-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171681474 |
| Molecular Formula | C33H34F3N3O2 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | 1-benzyl-N-[4-[1-[(E)-3-(3,4,5-trifluorophenyl)prop-2-enoyl]piperidin-4-yl]phenyl]piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(C2CCN(C(=O)/C=C/c3cc(F)c(F)c(F)c3)CC2)cc1)C1CCCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C33H34F3N3O2/c34-29-19-24(20-30(35)32(29)36)8-13-31(40)39-17-14-26(15-18-39)25-9-11-28(12-10-25)37-33(41)27-7-4-16-38(22-27)21-23-5-2-1-3-6-23/h1-3,5-6,8-13,19-20,26-27H,4,7,14-18,21-22H2,(H,37,41)/b13-8+ |
| InChIKey | CCSXZEMRSROQPD-MDWZMJQESA-N |
| XLogP | 6.37 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|