C30H26Cl2FN3O3 — CID 171683646
(E)-N-benzyl-4-[1'-(3,4-dichlorobenzoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl]-4-oxobut-2-enamide (PubChem CID 171683646) has the molecular formula C30H26Cl2FN3O3 and a molecular weight of 566.46 g/mol. Its IUPAC name is (E)-N-benzyl-4-[1'-(3,4-dichlorobenzoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl]-4-oxobut-2-enamide.
| Compound Name | (E)-N-benzyl-4-[1'-(3,4-dichlorobenzoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl]-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 171683646 |
| Molecular Formula | C30H26Cl2FN3O3 |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | (E)-N-benzyl-4-[1'-(3,4-dichlorobenzoyl)-5-fluorospiro[2H-indole-3,4'-piperidine]-1-yl]-4-oxobut-2-enamide |
| SMILES | O=C(/C=C/C(=O)N1CC2(CCN(C(=O)c3ccc(Cl)c(Cl)c3)CC2)c2cc(F)ccc21)NCc1ccccc1 |
| InChI | InChI=1S/C30H26Cl2FN3O3/c31-24-8-6-21(16-25(24)32)29(39)35-14-12-30(13-15-35)19-36(26-9-7-22(33)17-23(26)30)28(38)11-10-27(37)34-18-20-4-2-1-3-5-20/h1-11,16-17H,12-15,18-19H2,(H,34,37)/b11-10+ |
| InChIKey | TVSDMBRZQGUKJO-ZHACJKMWSA-N |
| XLogP | 5.53 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|