C28H24Cl2N2O3S — CID 88587625
N-[[1'-(3,4-dichlorobenzoyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-5-yl]methyl]-2-formylbenzamide (PubChem CID 88587625) has the molecular formula C28H24Cl2N2O3S and a molecular weight of 539.48 g/mol. Its IUPAC name is N-[[1'-(3,4-dichlorobenzoyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-5-yl]methyl]-2-formylbenzamide.
| Compound Name | N-[[1'-(3,4-dichlorobenzoyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-5-yl]methyl]-2-formylbenzamide |
|---|---|
| PubChem CID | 88587625 |
| Molecular Formula | C28H24Cl2N2O3S |
| Molecular Weight | 539.48 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | N-[[1'-(3,4-dichlorobenzoyl)spiro[2H-1-benzothiophene-3,4'-piperidine]-5-yl]methyl]-2-formylbenzamide |
| SMILES | O=Cc1ccccc1C(=O)NCc1ccc2c(c1)C1(CCN(C(=O)c3ccc(Cl)c(Cl)c3)CC1)CS2 |
| InChI | InChI=1S/C28H24Cl2N2O3S/c29-23-7-6-19(14-24(23)30)27(35)32-11-9-28(10-12-32)17-36-25-8-5-18(13-22(25)28)15-31-26(34)21-4-2-1-3-20(21)16-33/h1-8,13-14,16H,9-12,15,17H2,(H,31,34) |
| InChIKey | PATLZUXEJCXUEJ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.48 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|