C29H28F3N3O4 — CID 171683802
1-[(3aS,6aS)-5-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-(2,5-dimethoxyphenyl)propan-1-one (PubChem CID 171683802) has the molecular formula C29H28F3N3O4 and a molecular weight of 539.55 g/mol. Its IUPAC name is 1-[(3aS,6aS)-5-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-(2,5-dimethoxyphenyl)propan-1-one.
| Compound Name | 1-[(3aS,6aS)-5-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-(2,5-dimethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 171683802 |
| Molecular Formula | C29H28F3N3O4 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 1-[(3aS,6aS)-5-[6-(2,6-difluorophenyl)-5-fluoropyridine-2-carbonyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-1-yl]-3-(2,5-dimethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(OC)c(CCC(=O)N2CC[C@H]3CN(C(=O)c4ccc(F)c(-c5c(F)cccc5F)n4)C[C@H]32)c1 |
| InChI | InChI=1S/C29H28F3N3O4/c1-38-19-7-10-25(39-2)17(14-19)6-11-26(36)35-13-12-18-15-34(16-24(18)35)29(37)23-9-8-22(32)28(33-23)27-20(30)4-3-5-21(27)31/h3-5,7-10,14,18,24H,6,11-13,15-16H2,1-2H3/t18-,24+/m0/s1 |
| InChIKey | ISOFBDJSDAFNIA-MHECFPHRSA-N |
| XLogP | 4.49 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |