C31H28ClN3O4 — CID 171685515
N-[4-[1-(3-acetamidobenzoyl)piperidin-4-yl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 171685515) has the molecular formula C31H28ClN3O4 and a molecular weight of 542.04 g/mol. Its IUPAC name is N-[4-[1-(3-acetamidobenzoyl)piperidin-4-yl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[4-[1-(3-acetamidobenzoyl)piperidin-4-yl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 171685515 |
| Molecular Formula | C31H28ClN3O4 |
| Molecular Weight | 542.04 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | N-[4-[1-(3-acetamidobenzoyl)piperidin-4-yl]phenyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(C(=O)N2CCC(c3ccc(NC(=O)c4ccc(-c5ccc(Cl)cc5)o4)cc3)CC2)c1 |
| InChI | InChI=1S/C31H28ClN3O4/c1-20(36)33-27-4-2-3-24(19-27)31(38)35-17-15-22(16-18-35)21-7-11-26(12-8-21)34-30(37)29-14-13-28(39-29)23-5-9-25(32)10-6-23/h2-14,19,22H,15-18H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | IZFFLPLJUPQQSJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.04 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |