C17H25N5O3 — CID 171692489
formic acid;1-methyl-4-prop-2-enyl-9-pyrazin-2-yl-1,4,9-triazaspiro[5.5]undecan-5-one (PubChem CID 171692489) has the molecular formula C17H25N5O3 and a molecular weight of 347.42 g/mol. Its IUPAC name is formic acid;1-methyl-4-prop-2-enyl-9-pyrazin-2-yl-1,4,9-triazaspiro[5.5]undecan-5-one.
| Compound Name | formic acid;1-methyl-4-prop-2-enyl-9-pyrazin-2-yl-1,4,9-triazaspiro[5.5]undecan-5-one |
|---|---|
| PubChem CID | 171692489 |
| Molecular Formula | C17H25N5O3 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | formic acid;1-methyl-4-prop-2-enyl-9-pyrazin-2-yl-1,4,9-triazaspiro[5.5]undecan-5-one |
| SMILES | C=CCN1CCN(C)C2(CCN(c3cnccn3)CC2)C1=O.O=CO |
| InChI | InChI=1S/C16H23N5O.CH2O2/c1-3-8-21-12-11-19(2)16(15(21)22)4-9-20(10-5-16)14-13-17-6-7-18-14;2-1-3/h3,6-7,13H,1,4-5,8-12H2,2H3;1H,(H,2,3) |
| InChIKey | FNVRDTYMRUMOHM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|