C20H30F6N4O6S — CID 171694446
N,N-dimethyl-2-[4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 171694446) has the molecular formula C20H30F6N4O6S and a molecular weight of 568.54 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-2-[4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 171694446 |
| Molecular Formula | C20H30F6N4O6S |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.18 |
| IUPAC Name | N,N-dimethyl-2-[4-(1,3-thiazol-2-ylmethyl)-1,11-dioxa-4,8-diazaspiro[5.6]dodecan-8-yl]ethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)CCN1CCOCC2(C1)CN(Cc1nccs1)CCO2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H28N4O2S.2C2HF3O2/c1-18(2)4-5-19-6-8-21-14-16(12-19)13-20(7-9-22-16)11-15-17-3-10-23-15;2*3-2(4,5)1(6)7/h3,10H,4-9,11-14H2,1-2H3;2*(H,6,7) |
| InChIKey | BJFDESWOGZLPRW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 115.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |