C29H21F6O3S+ — CID 171721905
[4-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxycarbonyl]phenyl]-diphenylsulfanium (PubChem CID 171721905) has the molecular formula C29H21F6O3S+ and a molecular weight of 563.54 g/mol. Its IUPAC name is [4-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxycarbonyl]phenyl]-diphenylsulfanium.
| Compound Name | [4-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxycarbonyl]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 171721905 |
| Molecular Formula | C29H21F6O3S+ |
| Molecular Weight | 563.54 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | [4-[2-[3,5-bis(trifluoromethyl)phenoxy]ethoxycarbonyl]phenyl]-diphenylsulfanium |
| SMILES | O=C(OCCOc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C29H21F6O3S/c30-28(31,32)21-17-22(29(33,34)35)19-23(18-21)37-15-16-38-27(36)20-11-13-26(14-12-20)39(24-7-3-1-4-8-24)25-9-5-2-6-10-25/h1-14,17-19H,15-16H2/q+1 |
| InChIKey | NCPDLVRCTXPLMG-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.54 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|