C50H48IrN2OSi-2 — CID 171724070
iridium;4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane (PubChem CID 171724070) has the molecular formula C50H48IrN2OSi-2 and a molecular weight of 916.27 g/mol. Its IUPAC name is iridium;4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane.
| Compound Name | iridium;4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
|---|---|
| PubChem CID | 171724070 |
| Molecular Formula | C50H48IrN2OSi-2 |
| Molecular Weight | 916.27 g/mol |
| Exact Mass | 916.34 |
| IUPAC Name | iridium;4-[4-phenyl-2,6-di(propan-2-yl)phenyl]-2-[6-(trideuteriomethyl)-3H-dibenzofuran-3-id-4-yl]pyridine;trimethyl-(6-phenyl-3-pyridinyl)silane |
| SMILES | C[Si](C)(C)c1ccc(-c2[c-]cccc2)nc1.[2H]C([2H])([2H])c1cccc2c1oc1c(-c3cc(-c4c(C(C)C)cc(-c5ccccc5)cc4C(C)C)ccn3)[c-]ccc12.[Ir] |
| InChI | InChI=1S/C36H32NO.C14H16NSi.Ir/c1-22(2)31-19-27(25-12-7-6-8-13-25)20-32(23(3)4)34(31)26-17-18-37-33(21-26)30-16-10-15-29-28-14-9-11-24(5)35(28)38-36(29)30;1-16(2,3)13-9-10-14(15-11-13)12-7-5-4-6-8-12;/h6-15,17-23H,1-5H3;4-7,9-11H,1-3H3;/q2*-1;/i5D3;; |
| InChIKey | WORNKUQWRXPNKJ-YLSPSJLGSA-N |
| XLogP | 13.43 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.27 |
| LogP ≤ 5 | 13.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|