C34H68F6NO4PS2 — CID 171726592
1,1,1-trifluoro-N-(trifluoromethylsulfonyl)-N-[tris(2-ethylhexyl)-octyl-λ5-phosphanyl]methanesulfonamide (PubChem CID 171726592) has the molecular formula C34H68F6NO4PS2 and a molecular weight of 764.02 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(trifluoromethylsulfonyl)-N-[tris(2-ethylhexyl)-octyl-λ5-phosphanyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(trifluoromethylsulfonyl)-N-[tris(2-ethylhexyl)-octyl-λ5-phosphanyl]methanesulfonamide |
|---|---|
| PubChem CID | 171726592 |
| Molecular Formula | C34H68F6NO4PS2 |
| Molecular Weight | 764.02 g/mol |
| Exact Mass | 763.42 |
| IUPAC Name | 1,1,1-trifluoro-N-(trifluoromethylsulfonyl)-N-[tris(2-ethylhexyl)-octyl-λ5-phosphanyl]methanesulfonamide |
| SMILES | CCCCCCCCP(CC(CC)CCCC)(CC(CC)CCCC)(CC(CC)CCCC)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C34H68F6NO4PS2/c1-8-15-19-20-21-22-26-46(27-30(12-5)23-16-9-2,28-31(13-6)24-17-10-3,29-32(14-7)25-18-11-4)41(47(42,43)33(35,36)37)48(44,45)34(38,39)40/h30-32H,8-29H2,1-7H3 |
| InChIKey | SKJIJTPFSKUYKF-UHFFFAOYSA-N |
| XLogP | 12.47 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.02 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|