C16H30F6NO6PS2 — CID 156631436
2-[[bis(trifluoromethylsulfonyl)amino]-tributyl-λ5-phosphanyl]acetic acid (PubChem CID 156631436) has the molecular formula C16H30F6NO6PS2 and a molecular weight of 541.51 g/mol. Its IUPAC name is 2-[[bis(trifluoromethylsulfonyl)amino]-tributyl-λ5-phosphanyl]acetic acid.
| Compound Name | 2-[[bis(trifluoromethylsulfonyl)amino]-tributyl-λ5-phosphanyl]acetic acid |
|---|---|
| PubChem CID | 156631436 |
| Molecular Formula | C16H30F6NO6PS2 |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 541.12 |
| IUPAC Name | 2-[[bis(trifluoromethylsulfonyl)amino]-tributyl-λ5-phosphanyl]acetic acid |
| SMILES | CCCCP(CCCC)(CCCC)(CC(=O)O)N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H30F6NO6PS2/c1-4-7-10-30(11-8-5-2,12-9-6-3,13-14(24)25)23(31(26,27)15(17,18)19)32(28,29)16(20,21)22/h4-13H2,1-3H3,(H,24,25) |
| InChIKey | TXCXXPUTBMHLFR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 108.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|