C56H50N3NaO7S — CID 171729894
sodium 4-[4,5-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]butane-2-sulfonate (PubChem CID 171729894) has the molecular formula C56H50N3NaO7S and a molecular weight of 932.09 g/mol. Its IUPAC name is sodium 4-[4,5-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]butane-2-sulfonate.
| Compound Name | sodium 4-[4,5-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]butane-2-sulfonate |
|---|---|
| PubChem CID | 171729894 |
| Molecular Formula | C56H50N3NaO7S |
| Molecular Weight | 932.09 g/mol |
| Exact Mass | 931.33 |
| IUPAC Name | sodium 4-[4,5-bis[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]carbazol-9-yl]butane-2-sulfonate |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc(-c3cccc4c3c3c(-c5ccc(N(c6ccc(OC)cc6)c6ccc(OC)cc6)cc5)cccc3n4CCC(C)S(=O)(=O)[O-])cc2)cc1.[Na+] |
| InChI | InChI=1S/C56H51N3O7S.Na/c1-38(67(60,61)62)36-37-57-53-10-6-8-51(39-12-16-41(17-13-39)58(43-20-28-47(63-2)29-21-43)44-22-30-48(64-3)31-23-44)55(53)56-52(9-7-11-54(56)57)40-14-18-42(19-15-40)59(45-24-32-49(65-4)33-25-45)46-26-34-50(66-5)35-27-46;/h6-35,38H,36-37H2,1-5H3,(H,60,61,62);/q;+1/p-1 |
| InChIKey | UPKXLFGWRUSNQB-UHFFFAOYSA-M |
| XLogP | 10.43 |
| TPSA | 105.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.09 |
| LogP ≤ 5 | 10.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|