C44H42CsN3O7S2 — CID 172538257
cesium 4-[2,8-bis(4-methoxy-N-(4-methoxyphenyl)anilino)phenothiazin-10-yl]butane-2-sulfonate (PubChem CID 172538257) has the molecular formula C44H42CsN3O7S2 and a molecular weight of 921.87 g/mol. Its IUPAC name is cesium 4-[2,8-bis(4-methoxy-N-(4-methoxyphenyl)anilino)phenothiazin-10-yl]butane-2-sulfonate.
| Compound Name | cesium 4-[2,8-bis(4-methoxy-N-(4-methoxyphenyl)anilino)phenothiazin-10-yl]butane-2-sulfonate |
|---|---|
| PubChem CID | 172538257 |
| Molecular Formula | C44H42CsN3O7S2 |
| Molecular Weight | 921.87 g/mol |
| Exact Mass | 921.15 |
| IUPAC Name | cesium 4-[2,8-bis(4-methoxy-N-(4-methoxyphenyl)anilino)phenothiazin-10-yl]butane-2-sulfonate |
| SMILES | COc1ccc(N(c2ccc(OC)cc2)c2ccc3c(c2)N(CCC(C)S(=O)(=O)[O-])c2cc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)ccc2S3)cc1.[Cs+] |
| InChI | InChI=1S/C44H43N3O7S2.Cs/c1-30(56(48,49)50)26-27-45-41-28-35(46(31-6-16-37(51-2)17-7-31)32-8-18-38(52-3)19-9-32)14-24-43(41)55-44-25-15-36(29-42(44)45)47(33-10-20-39(53-4)21-11-33)34-12-22-40(54-5)23-13-34;/h6-25,28-30H,26-27H2,1-5H3,(H,48,49,50);/q;+1/p-1 |
| InChIKey | JUVWTZAWHUINAN-UHFFFAOYSA-M |
| XLogP | 7.59 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.87 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|