C38H36N2O5S2 — CID 172538208
(E)-1-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]phenothiazin-10-yl]hex-4-ene-3-sulfonic acid (PubChem CID 172538208) has the molecular formula C38H36N2O5S2 and a molecular weight of 664.85 g/mol. Its IUPAC name is (E)-1-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]phenothiazin-10-yl]hex-4-ene-3-sulfonic acid.
| Compound Name | (E)-1-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]phenothiazin-10-yl]hex-4-ene-3-sulfonic acid |
|---|---|
| PubChem CID | 172538208 |
| Molecular Formula | C38H36N2O5S2 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.21 |
| IUPAC Name | (E)-1-[2-[4-(4-methoxy-N-(4-methoxyphenyl)anilino)phenyl]phenothiazin-10-yl]hex-4-ene-3-sulfonic acid |
| SMILES | C/C=C/C(CCN1c2ccccc2Sc2ccc(-c3ccc(N(c4ccc(OC)cc4)c4ccc(OC)cc4)cc3)cc21)S(=O)(=O)O |
| InChI | InChI=1S/C38H36N2O5S2/c1-4-7-34(47(41,42)43)24-25-39-35-8-5-6-9-37(35)46-38-23-12-28(26-36(38)39)27-10-13-29(14-11-27)40(30-15-19-32(44-2)20-16-30)31-17-21-33(45-3)22-18-31/h4-23,26,34H,24-25H2,1-3H3,(H,41,42,43)/b7-4+ |
| InChIKey | ROLYDJRGFVHLAQ-QPJJXVBHSA-N |
| XLogP | 9.67 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|