C23H35N3O6S4 — CID 173327761
N,N-diethylethanamine;4-[2-[3-(2-hydroxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-5-methoxy-1,3-benzothiazol-3-yl]butane-2-sulfonic acid (PubChem CID 173327761) has the molecular formula C23H35N3O6S4 and a molecular weight of 577.82 g/mol. Its IUPAC name is N,N-diethylethanamine;4-[2-[3-(2-hydroxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-5-methoxy-1,3-benzothiazol-3-yl]butane-2-sulfonic acid.
| Compound Name | N,N-diethylethanamine;4-[2-[3-(2-hydroxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-5-methoxy-1,3-benzothiazol-3-yl]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 173327761 |
| Molecular Formula | C23H35N3O6S4 |
| Molecular Weight | 577.82 g/mol |
| Exact Mass | 577.14 |
| IUPAC Name | N,N-diethylethanamine;4-[2-[3-(2-hydroxyethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]-5-methoxy-1,3-benzothiazol-3-yl]butane-2-sulfonic acid |
| SMILES | CCN(CC)CC.COc1ccc2c(c1)N(CCC(C)S(=O)(=O)O)C(=C1SC(=S)N(CCO)C1=O)S2 |
| InChI | InChI=1S/C17H20N2O6S4.C6H15N/c1-10(29(22,23)24)5-6-18-12-9-11(25-2)3-4-13(12)27-16(18)14-15(21)19(7-8-20)17(26)28-14;1-4-7(5-2)6-3/h3-4,9-10,20H,5-8H2,1-2H3,(H,22,23,24);4-6H2,1-3H3 |
| InChIKey | AFLSUGVPLKXOJW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.82 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|