C18H13FN2O2S3 — CID 3272414
3-(4-fluorophenyl)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 3272414) has the molecular formula C18H13FN2O2S3 and a molecular weight of 404.51 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(4-fluorophenyl)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 3272414 |
| Molecular Formula | C18H13FN2O2S3 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | 3-(4-fluorophenyl)-5-(5-methoxy-3-methyl-1,3-benzothiazol-2-ylidene)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc2c(c1)N(C)C(=C1SC(=S)N(c3ccc(F)cc3)C1=O)S2 |
| InChI | InChI=1S/C18H13FN2O2S3/c1-20-13-9-12(23-2)7-8-14(13)25-17(20)15-16(22)21(18(24)26-15)11-5-3-10(19)4-6-11/h3-9H,1-2H3 |
| InChIKey | KJTJIZJHHZDSHF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|