C42H33FIrN3O- — CID 171730728
1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;2-[1-(2,6-dimethylphenyl)benzimidazol-2-yl]phenol;iridium (PubChem CID 171730728) has the molecular formula C42H33FIrN3O- and a molecular weight of 806.96 g/mol. Its IUPAC name is 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;2-[1-(2,6-dimethylphenyl)benzimidazol-2-yl]phenol;iridium.
| Compound Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;2-[1-(2,6-dimethylphenyl)benzimidazol-2-yl]phenol;iridium |
|---|---|
| PubChem CID | 171730728 |
| Molecular Formula | C42H33FIrN3O- |
| Molecular Weight | 806.96 g/mol |
| Exact Mass | 807.22 |
| IUPAC Name | 1-(3,5-dimethylbenzene-6-id-1-yl)-6-fluorobenzo[h]isoquinoline;2-[1-(2,6-dimethylphenyl)benzimidazol-2-yl]phenol;iridium |
| SMILES | Cc1[c-]c(-c2nccc3cc(F)c4ccccc4c23)cc(C)c1.Cc1cccc(C)c1-n1c(-c2ccccc2O)nc2ccccc21.[Ir] |
| InChI | InChI=1S/C21H15FN.C21H18N2O.Ir/c1-13-9-14(2)11-16(10-13)21-20-15(7-8-23-21)12-19(22)17-5-3-4-6-18(17)20;1-14-8-7-9-15(2)20(14)23-18-12-5-4-11-17(18)22-21(23)16-10-3-6-13-19(16)24;/h3-10,12H,1-2H3;3-13,24H,1-2H3;/q-1;; |
| InChIKey | VGGZJZLKTNFCMO-UHFFFAOYSA-N |
| XLogP | 10.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.96 |
| LogP ≤ 5 | 10.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|